ChemNet > CAS > 175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
Ονομασία του προϊόντος |
3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid |
Συνώνυμα |
3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
MF |
C15H10ClNO4S |
Μοριακό βάρος |
335.7622 |
InChI |
InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
CAS ΟΧΙ |
175278-51-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.5g/cm3 |
Σημείο τήξης |
212℃ |
Σημείο βρασμού |
531.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.694 |
Σημείο ανάφλεξης |
275.4°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|